C25H26ClNO5 — CID 108750346
6-chloro-8-methyl-1'-[2-(2-prop-2-enoxyphenoxy)acetyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108750346) has the molecular formula C25H26ClNO5 and a molecular weight of 455.94 g/mol. Its IUPAC name is 6-chloro-8-methyl-1'-[2-(2-prop-2-enoxyphenoxy)acetyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-8-methyl-1'-[2-(2-prop-2-enoxyphenoxy)acetyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108750346 |
| Molecular Formula | C25H26ClNO5 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 6-chloro-8-methyl-1'-[2-(2-prop-2-enoxyphenoxy)acetyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | C=CCOc1ccccc1OCC(=O)N1CCC2(CC1)CC(=O)c1cc(Cl)cc(C)c1O2 |
| InChI | InChI=1S/C25H26ClNO5/c1-3-12-30-21-6-4-5-7-22(21)31-16-23(29)27-10-8-25(9-11-27)15-20(28)19-14-18(26)13-17(2)24(19)32-25/h3-7,13-14H,1,8-12,15-16H2,2H3 |
| InChIKey | PODLCVMCNWUPCG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|