C23H21Cl2NO3 — CID 108750309
6-chloro-1'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108750309) has the molecular formula C23H21Cl2NO3 and a molecular weight of 430.33 g/mol. Its IUPAC name is 6-chloro-1'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-1'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108750309 |
| Molecular Formula | C23H21Cl2NO3 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 6-chloro-1'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-8-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(Cl)cc2c1OC1(CCN(C(=O)/C=C/c3cccc(Cl)c3)CC1)CC2=O |
| InChI | InChI=1S/C23H21Cl2NO3/c1-15-11-18(25)13-19-20(27)14-23(29-22(15)19)7-9-26(10-8-23)21(28)6-5-16-3-2-4-17(24)12-16/h2-6,11-13H,7-10,14H2,1H3/b6-5+ |
| InChIKey | UARIILZEUWBCSJ-AATRIKPKSA-N |
| XLogP | 5.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|