C24H23Cl2NO3 — CID 108757959
1'-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-6,8-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108757959) has the molecular formula C24H23Cl2NO3 and a molecular weight of 444.36 g/mol. Its IUPAC name is 1'-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-6,8-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-6,8-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108757959 |
| Molecular Formula | C24H23Cl2NO3 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 1'-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-6,8-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(C)c2c(c1)C(=O)CC1(CCN(C(=O)/C=C/c3ccc(Cl)cc3Cl)CC1)O2 |
| InChI | InChI=1S/C24H23Cl2NO3/c1-15-11-16(2)23-19(12-15)21(28)14-24(30-23)7-9-27(10-8-24)22(29)6-4-17-3-5-18(25)13-20(17)26/h3-6,11-13H,7-10,14H2,1-2H3/b6-4+ |
| InChIKey | IGJUSSPWCIRSGS-GQCTYLIASA-N |
| XLogP | 5.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|