C24H22ClNO5 — CID 108758347
6-chloro-1'-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108758347) has the molecular formula C24H22ClNO5 and a molecular weight of 439.90 g/mol. Its IUPAC name is 6-chloro-1'-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-1'-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108758347 |
| Molecular Formula | C24H22ClNO5 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 6-chloro-1'-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C1CC2(CCN(C(=O)/C=C\c3ccc4c(c3)OCCO4)CC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H22ClNO5/c25-17-3-5-20-18(14-17)19(27)15-24(31-20)7-9-26(10-8-24)23(28)6-2-16-1-4-21-22(13-16)30-12-11-29-21/h1-6,13-14H,7-12,15H2/b6-2- |
| InChIKey | GYGXPGZMYFVWGR-KXFIGUGUSA-N |
| XLogP | 4.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|