C24H24ClNO5 — CID 108762658
1'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108762658) has the molecular formula C24H24ClNO5 and a molecular weight of 441.91 g/mol. Its IUPAC name is 1'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108762658 |
| Molecular Formula | C24H24ClNO5 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1ccc2c(c1OC)OC1(CCN(C(=O)/C=C/c3cccc(Cl)c3)CC1)CC2=O |
| InChI | InChI=1S/C24H24ClNO5/c1-29-20-8-7-18-19(27)15-24(31-22(18)23(20)30-2)10-12-26(13-11-24)21(28)9-6-16-4-3-5-17(25)14-16/h3-9,14H,10-13,15H2,1-2H3/b9-6+ |
| InChIKey | MMXRXGBEYAJEFQ-RMKNXTFCSA-N |
| XLogP | 4.40 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|