C24H23Cl2NO5 — CID 108762660
1'-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108762660) has the molecular formula C24H23Cl2NO5 and a molecular weight of 476.36 g/mol. Its IUPAC name is 1'-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108762660 |
| Molecular Formula | C24H23Cl2NO5 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 1'-[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1ccc2c(c1OC)OC1(CCN(C(=O)/C=C/c3ccc(Cl)cc3Cl)CC1)CC2=O |
| InChI | InChI=1S/C24H23Cl2NO5/c1-30-20-7-6-17-19(28)14-24(32-22(17)23(20)31-2)9-11-27(12-10-24)21(29)8-4-15-3-5-16(25)13-18(15)26/h3-8,13H,9-12,14H2,1-2H3/b8-4+ |
| InChIKey | GSIARWGQPODJHG-XBXARRHUSA-N |
| XLogP | 5.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|