C26H29NO7 — CID 108762667
1'-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108762667) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 1'-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108762667 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 1'-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-7,8-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC3(CC2)CC(=O)c2ccc(OC)c(OC)c2O3)cc1OC |
| InChI | InChI=1S/C26H29NO7/c1-30-20-8-5-17(15-22(20)32-3)6-10-23(29)27-13-11-26(12-14-27)16-19(28)18-7-9-21(31-2)25(33-4)24(18)34-26/h5-10,15H,11-14,16H2,1-4H3/b10-6+ |
| InChIKey | KGSUEAMMAHQZPE-UXBLZVDNSA-N |
| XLogP | 3.76 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|