C26H28ClNO6 — CID 108750325
6-chloro-8-methyl-1'-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108750325) has the molecular formula C26H28ClNO6 and a molecular weight of 485.96 g/mol. Its IUPAC name is 6-chloro-8-methyl-1'-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-8-methyl-1'-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108750325 |
| Molecular Formula | C26H28ClNO6 |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 6-chloro-8-methyl-1'-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCC3(CC2)CC(=O)c2cc(Cl)cc(C)c2O3)cc(OC)c1OC |
| InChI | InChI=1S/C26H28ClNO6/c1-16-11-18(27)14-19-20(29)15-26(34-24(16)19)7-9-28(10-8-26)23(30)6-5-17-12-21(31-2)25(33-4)22(13-17)32-3/h5-6,11-14H,7-10,15H2,1-4H3/b6-5+ |
| InChIKey | RNEFCONIHRWYRE-AATRIKPKSA-N |
| XLogP | 4.71 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|