C16H17BrClNO3 — CID 108758290
1'-(2-bromopropanoyl)-6-chlorospiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108758290) has the molecular formula C16H17BrClNO3 and a molecular weight of 386.67 g/mol. Its IUPAC name is 1'-(2-bromopropanoyl)-6-chlorospiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-(2-bromopropanoyl)-6-chlorospiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108758290 |
| Molecular Formula | C16H17BrClNO3 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 1'-(2-bromopropanoyl)-6-chlorospiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | CC(Br)C(=O)N1CCC2(CC1)CC(=O)c1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C16H17BrClNO3/c1-10(17)15(21)19-6-4-16(5-7-19)9-13(20)12-8-11(18)2-3-14(12)22-16/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | NSHNKFDOPQFEGN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|