C18H22ClNO4 — CID 108735122
butyl 6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 108735122) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is butyl 6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | butyl 6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 108735122 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | butyl 6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)CC(=O)c1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C18H22ClNO4/c1-2-3-10-23-17(22)20-8-6-18(7-9-20)12-15(21)14-11-13(19)4-5-16(14)24-18/h4-5,11H,2-3,6-10,12H2,1H3 |
| InChIKey | BCLGJMCATOHCAH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|