C20H27NO6 — CID 108726300
butyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 108726300) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is butyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | butyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 108726300 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | butyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCCCOC(=O)N1CCC2(CC1)CC(=O)c1c(OC)cc(OC)cc1O2 |
| InChI | InChI=1S/C20H27NO6/c1-4-5-10-26-19(23)21-8-6-20(7-9-21)13-15(22)18-16(25-3)11-14(24-2)12-17(18)27-20/h11-12H,4-10,13H2,1-3H3 |
| InChIKey | HWGGTIQETZQBHA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|