About 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate
2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 108726303) has the molecular formula C24H35NO6
and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| PubChem CID | 108726303 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCCCC(CC)COC(=O)N1CCC2(CC1)CC(=O)c1c(OC)cc(OC)cc1O2 |
| InChI | InChI=1S/C24H35NO6/c1-5-7-8-17(6-2)16-30-23(27)25-11-9-24(10-12-25)15-19(26)22-20(29-4)13-18(28-3)14-21(22)31-24/h13-14,17H,5-12,15-16H2,1-4H3 |
| InChIKey | QURIBBYFXMHIBW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The IUPAC name of 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CID 108726303) is 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The canonical SMILES for 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate is CCCCC(CC)COC(=O)N1CCC2(CC1)CC(=O)c1c(OC)cc(OC)cc1O2.
What is the InChIKey of 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The InChIKey is QURIBBYFXMHIBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35NO6/c1-5-7-8-17(6-2)16-30-23(27)25-11-9-24(10-12-25)15-19(26)22-20(29-4)13-18(28-3)14-21(22)31-24/h13-14,17H,5-12,15-16H2,1-4H3.
What are the key properties of 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate has a molecular weight of 433.55 g/mol, XLogP of 4.86, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 108726303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).