C25H24N2O7 — CID 108750406
2-[2-(5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]isoindole-1,3-dione (PubChem CID 108750406) has the molecular formula C25H24N2O7 and a molecular weight of 464.47 g/mol. Its IUPAC name is 2-[2-(5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108750406 |
| Molecular Formula | C25H24N2O7 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[2-(5,7-dimethoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-2-oxoethyl]isoindole-1,3-dione |
| SMILES | COc1cc(OC)c2c(c1)OC1(CCN(C(=O)CN3C(=O)c4ccccc4C3=O)CC1)CC2=O |
| InChI | InChI=1S/C25H24N2O7/c1-32-15-11-19(33-2)22-18(28)13-25(34-20(22)12-15)7-9-26(10-8-25)21(29)14-27-23(30)16-5-3-4-6-17(16)24(27)31/h3-6,11-12H,7-10,13-14H2,1-2H3 |
| InChIKey | UPMYVXPSDKIKTI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|