C19H23NO5 — CID 108750369
1'-[(E)-but-2-enoyl]-5,7-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108750369) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1'-[(E)-but-2-enoyl]-5,7-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-[(E)-but-2-enoyl]-5,7-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108750369 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1'-[(E)-but-2-enoyl]-5,7-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | C/C=C/C(=O)N1CCC2(CC1)CC(=O)c1c(OC)cc(OC)cc1O2 |
| InChI | InChI=1S/C19H23NO5/c1-4-5-17(22)20-8-6-19(7-9-20)12-14(21)18-15(24-3)10-13(23-2)11-16(18)25-19/h4-5,10-11H,6-9,12H2,1-3H3/b5-4+ |
| InChIKey | YWDUCIRWYKGYKR-SNAWJCMRSA-N |
| XLogP | 2.61 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|