C22H24N2O4S — CID 108780314
5,7-dimethoxy-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide (PubChem CID 108780314) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 5,7-dimethoxy-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide.
| Compound Name | 5,7-dimethoxy-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
|---|---|
| PubChem CID | 108780314 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5,7-dimethoxy-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
| SMILES | COc1cc(OC)c2c(c1)OC1(CCN(C(=S)Nc3ccccc3)CC1)CC2=O |
| InChI | InChI=1S/C22H24N2O4S/c1-26-16-12-18(27-2)20-17(25)14-22(28-19(20)13-16)8-10-24(11-9-22)21(29)23-15-6-4-3-5-7-15/h3-7,12-13H,8-11,14H2,1-2H3,(H,23,29) |
| InChIKey | SAXDHPPVGTZMIZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|