C21H22N2O3S — CID 108782006
7-methoxy-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide (PubChem CID 108782006) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is 7-methoxy-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide.
| Compound Name | 7-methoxy-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
|---|---|
| PubChem CID | 108782006 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 7-methoxy-4-oxo-N-phenylspiro[3H-chromene-2,4'-piperidine]-1'-carbothioamide |
| SMILES | COc1ccc2c(c1)OC1(CCN(C(=S)Nc3ccccc3)CC1)CC2=O |
| InChI | InChI=1S/C21H22N2O3S/c1-25-16-7-8-17-18(24)14-21(26-19(17)13-16)9-11-23(12-10-21)20(27)22-15-5-3-2-4-6-15/h2-8,13H,9-12,14H2,1H3,(H,22,27) |
| InChIKey | XIEKDTZPZPCDJZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|