C26H26N2O5 — CID 108762522
2-[1-(5,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-1-oxopropan-2-yl]isoindole-1,3-dione (PubChem CID 108762522) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-[1-(5,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-1-oxopropan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(5,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-1-oxopropan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108762522 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[1-(5,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-1-oxopropan-2-yl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)c2c(c1)OC1(CCN(C(=O)C(C)N3C(=O)c4ccccc4C3=O)CC1)CC2=O |
| InChI | InChI=1S/C26H26N2O5/c1-15-12-16(2)22-20(29)14-26(33-21(22)13-15)8-10-27(11-9-26)23(30)17(3)28-24(31)18-6-4-5-7-19(18)25(28)32/h4-7,12-13,17H,8-11,14H2,1-3H3 |
| InChIKey | YRYJHFXUMGQGTG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|