C18H12N4O9 — CID 2775587
4-(morpholine-4-carbonyl)-2,5,7-trinitrofluoren-9-one (PubChem CID 2775587) has the molecular formula C18H12N4O9 and a molecular weight of 428.31 g/mol. Its IUPAC name is 4-(morpholine-4-carbonyl)-2,5,7-trinitrofluoren-9-one.
| Compound Name | 4-(morpholine-4-carbonyl)-2,5,7-trinitrofluoren-9-one |
|---|---|
| PubChem CID | 2775587 |
| Molecular Formula | C18H12N4O9 |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-(morpholine-4-carbonyl)-2,5,7-trinitrofluoren-9-one |
| SMILES | O=C1c2cc([N+](=O)[O-])cc(C(=O)N3CCOCC3)c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C18H12N4O9/c23-17-11-5-9(20(25)26)7-13(18(24)19-1-3-31-4-2-19)15(11)16-12(17)6-10(21(27)28)8-14(16)22(29)30/h5-8H,1-4H2 |
| InChIKey | GNZPQSSEUUBLJK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 176.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|