C21H13N5O6 — CID 4136209
2-[4-(morpholine-4-carbonyl)-2,7-dinitrofluoren-9-ylidene]propanedinitrile (PubChem CID 4136209) has the molecular formula C21H13N5O6 and a molecular weight of 431.36 g/mol. Its IUPAC name is 2-[4-(morpholine-4-carbonyl)-2,7-dinitrofluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[4-(morpholine-4-carbonyl)-2,7-dinitrofluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 4136209 |
| Molecular Formula | C21H13N5O6 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-[4-(morpholine-4-carbonyl)-2,7-dinitrofluoren-9-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc([N+](=O)[O-])ccc2-c2c(C(=O)N3CCOCC3)cc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C21H13N5O6/c22-10-12(11-23)19-16-7-13(25(28)29)1-2-15(16)20-17(19)8-14(26(30)31)9-18(20)21(27)24-3-5-32-6-4-24/h1-2,7-9H,3-6H2 |
| InChIKey | JQKUQTZEOKSGFV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 163.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|