C14H5N3O10 — CID 88625118
(4,5,7-trinitro-9-oxofluoren-2-yl) hydrogen carbonate (PubChem CID 88625118) has the molecular formula C14H5N3O10 and a molecular weight of 375.21 g/mol. Its IUPAC name is (4,5,7-trinitro-9-oxofluoren-2-yl) hydrogen carbonate.
| Compound Name | (4,5,7-trinitro-9-oxofluoren-2-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 88625118 |
| Molecular Formula | C14H5N3O10 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | (4,5,7-trinitro-9-oxofluoren-2-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1cc2c(c([N+](=O)[O-])c1)-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C14H5N3O10/c18-13-7-1-5(15(21)22)2-9(16(23)24)11(7)12-8(13)3-6(27-14(19)20)4-10(12)17(25)26/h1-4H,(H,19,20) |
| InChIKey | IYCNOIJGHIMDRE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 193.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|