1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid

C14H4ClN3O9 — CID 57209242

IUPAC1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid
SMILESO=C(O)c1cc([N+](=O)[O-])c2c(c1Cl)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2
InChIInChI=1S/C14H4ClN3O9/c15-12-6(14(20)21)3-8(18(26)27)10-9-5(13(19)11(10)12)1-4(16(22)23)2-7(9)17(24)25/h1-3H,(H,20,21)
InChIKeyIAKYTMULLJPARE-UHFFFAOYSA-N
MW393.65 g/mol
LogP2.97
Rot. Bonds4

About 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid

1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid (PubChem CID 57209242) has the molecular formula C14H4ClN3O9 and a molecular weight of 393.65 g/mol. Its IUPAC name is 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid.

Molecular Properties

Compound Name1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid
PubChem CID57209242
Molecular FormulaC14H4ClN3O9
Molecular Weight393.65 g/mol
Exact Mass392.96
IUPAC Name1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid
SMILESO=C(O)c1cc([N+](=O)[O-])c2c(c1Cl)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2
InChIInChI=1S/C14H4ClN3O9/c15-12-6(14(20)21)3-8(18(26)27)10-9-5(13(19)11(10)12)1-4(16(22)23)2-7(9)17(24)25/h1-3H,(H,20,21)
InChIKeyIAKYTMULLJPARE-UHFFFAOYSA-N
XLogP2.97
TPSA183.79 Ų
H-Bond Donors1
H-Bond Acceptors8
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500393.65
LogP ≤ 52.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid?
The IUPAC name of 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid (CID 57209242) is 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid.
What is the SMILES notation for 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid?
The canonical SMILES for 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid is O=C(O)c1cc([N+](=O)[O-])c2c(c1Cl)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2.
What is the InChIKey of 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid?
The InChIKey is IAKYTMULLJPARE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H4ClN3O9/c15-12-6(14(20)21)3-8(18(26)27)10-9-5(13(19)11(10)12)1-4(16(22)23)2-7(9)17(24)25/h1-3H,(H,20,21).
What are the key properties of 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid?
1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid has a molecular weight of 393.65 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid is sourced from PubChem (CID 57209242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).