C14H4ClN3O9 — CID 57209242
1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid (PubChem CID 57209242) has the molecular formula C14H4ClN3O9 and a molecular weight of 393.65 g/mol. Its IUPAC name is 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid.
| Compound Name | 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid |
|---|---|
| PubChem CID | 57209242 |
| Molecular Formula | C14H4ClN3O9 |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 1-chloro-4,5,7-trinitro-9-oxofluorene-2-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c2c(c1Cl)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C14H4ClN3O9/c15-12-6(14(20)21)3-8(18(26)27)10-9-5(13(19)11(10)12)1-4(16(22)23)2-7(9)17(24)25/h1-3H,(H,20,21) |
| InChIKey | IAKYTMULLJPARE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 183.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|