C20H10N4O8 — CID 2775590
2,5,7-trinitro-9-oxo-N-phenylfluorene-4-carboxamide (PubChem CID 2775590) has the molecular formula C20H10N4O8 and a molecular weight of 434.32 g/mol. Its IUPAC name is 2,5,7-trinitro-9-oxo-N-phenylfluorene-4-carboxamide.
| Compound Name | 2,5,7-trinitro-9-oxo-N-phenylfluorene-4-carboxamide |
|---|---|
| PubChem CID | 2775590 |
| Molecular Formula | C20H10N4O8 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2,5,7-trinitro-9-oxo-N-phenylfluorene-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C20H10N4O8/c25-19-13-6-11(22(27)28)8-15(20(26)21-10-4-2-1-3-5-10)17(13)18-14(19)7-12(23(29)30)9-16(18)24(31)32/h1-9H,(H,21,26) |
| InChIKey | MCYSNSDAEXVLRT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 175.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|