C22H15N5O8 — CID 6051228
(9Z)-9-hydroxyimino-2,5,7-trinitro-N-(1-phenylethyl)fluorene-4-carboxamide (PubChem CID 6051228) has the molecular formula C22H15N5O8 and a molecular weight of 477.39 g/mol. Its IUPAC name is (9Z)-9-hydroxyimino-2,5,7-trinitro-N-(1-phenylethyl)fluorene-4-carboxamide.
| Compound Name | (9Z)-9-hydroxyimino-2,5,7-trinitro-N-(1-phenylethyl)fluorene-4-carboxamide |
|---|---|
| PubChem CID | 6051228 |
| Molecular Formula | C22H15N5O8 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (9Z)-9-hydroxyimino-2,5,7-trinitro-N-(1-phenylethyl)fluorene-4-carboxamide |
| SMILES | CC(NC(=O)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])/C2=N\O)c1ccccc1 |
| InChI | InChI=1S/C22H15N5O8/c1-11(12-5-3-2-4-6-12)23-22(28)17-9-13(25(30)31)7-15-19(17)20-16(21(15)24-29)8-14(26(32)33)10-18(20)27(34)35/h2-11,29H,1H3,(H,23,28)/b24-21- |
| InChIKey | GPZYUPIULQBBTB-FLFQWRMESA-N |
| XLogP | 4.11 |
| TPSA | 191.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|