C15H9N3O7 — CID 6796429
methyl 9-hydroxyimino-2,7-dinitrofluorene-4-carboxylate (PubChem CID 6796429) has the molecular formula C15H9N3O7 and a molecular weight of 343.25 g/mol. Its IUPAC name is methyl 9-hydroxyimino-2,7-dinitrofluorene-4-carboxylate.
| Compound Name | methyl 9-hydroxyimino-2,7-dinitrofluorene-4-carboxylate |
|---|---|
| PubChem CID | 6796429 |
| Molecular Formula | C15H9N3O7 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | methyl 9-hydroxyimino-2,7-dinitrofluorene-4-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc2c1-c1ccc([N+](=O)[O-])cc1C2=NO |
| InChI | InChI=1S/C15H9N3O7/c1-25-15(19)12-6-8(18(23)24)5-11-13(12)9-3-2-7(17(21)22)4-10(9)14(11)16-20/h2-6,20H,1H3 |
| InChIKey | AFLYQPMYZODHAU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|