C17H12N2O8 — CID 2802144
2-methoxyethyl 2,7-dinitro-9-oxofluorene-4-carboxylate (PubChem CID 2802144) has the molecular formula C17H12N2O8 and a molecular weight of 372.29 g/mol. Its IUPAC name is 2-methoxyethyl 2,7-dinitro-9-oxofluorene-4-carboxylate.
| Compound Name | 2-methoxyethyl 2,7-dinitro-9-oxofluorene-4-carboxylate |
|---|---|
| PubChem CID | 2802144 |
| Molecular Formula | C17H12N2O8 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-methoxyethyl 2,7-dinitro-9-oxofluorene-4-carboxylate |
| SMILES | COCCOC(=O)c1cc([N+](=O)[O-])cc2c1-c1ccc([N+](=O)[O-])cc1C2=O |
| InChI | InChI=1S/C17H12N2O8/c1-26-4-5-27-17(21)14-8-10(19(24)25)7-13-15(14)11-3-2-9(18(22)23)6-12(11)16(13)20/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | AWYTWJUMNFGOMD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|