C17H12ClNO7 — CID 157056550
(2S)-2-chloropropanoic acid;7-nitro-9-oxofluorene-4-carboxylic acid (PubChem CID 157056550) has the molecular formula C17H12ClNO7 and a molecular weight of 377.74 g/mol. Its IUPAC name is (2S)-2-chloropropanoic acid;7-nitro-9-oxofluorene-4-carboxylic acid.
| Compound Name | (2S)-2-chloropropanoic acid;7-nitro-9-oxofluorene-4-carboxylic acid |
|---|---|
| PubChem CID | 157056550 |
| Molecular Formula | C17H12ClNO7 |
| Molecular Weight | 377.74 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2S)-2-chloropropanoic acid;7-nitro-9-oxofluorene-4-carboxylic acid |
| SMILES | C[C@H](Cl)C(=O)O.O=C(O)c1cccc2c1-c1ccc([N+](=O)[O-])cc1C2=O |
| InChI | InChI=1S/C14H7NO5.C3H5ClO2/c16-13-9-2-1-3-10(14(17)18)12(9)8-5-4-7(15(19)20)6-11(8)13;1-2(4)3(5)6/h1-6H,(H,17,18);2H,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | AAVBJYDRZKCYQE-WNQIDUERSA-N |
| XLogP | 3.20 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|