C10H3Cl2NO4 — CID 12883018
2,3-dichloro-6-nitronaphthalene-1,4-dione (PubChem CID 12883018) has the molecular formula C10H3Cl2NO4 and a molecular weight of 272.04 g/mol. Its IUPAC name is 2,3-dichloro-6-nitronaphthalene-1,4-dione.
| Compound Name | 2,3-dichloro-6-nitronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 12883018 |
| Molecular Formula | C10H3Cl2NO4 |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 270.94 |
| IUPAC Name | 2,3-dichloro-6-nitronaphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C10H3Cl2NO4/c11-7-8(12)10(15)6-3-4(13(16)17)1-2-5(6)9(7)14/h1-3H |
| InChIKey | NQKHIWJEMSIMRV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|