C20H25NO6 — CID 23038722
2,3-bis(2,2-dimethylpropoxy)-6-nitronaphthalene-1,4-dione (PubChem CID 23038722) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2,3-bis(2,2-dimethylpropoxy)-6-nitronaphthalene-1,4-dione.
| Compound Name | 2,3-bis(2,2-dimethylpropoxy)-6-nitronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 23038722 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2,3-bis(2,2-dimethylpropoxy)-6-nitronaphthalene-1,4-dione |
| SMILES | CC(C)(C)COC1=C(OCC(C)(C)C)C(=O)c2cc([N+](=O)[O-])ccc2C1=O |
| InChI | InChI=1S/C20H25NO6/c1-19(2,3)10-26-17-15(22)13-8-7-12(21(24)25)9-14(13)16(23)18(17)27-11-20(4,5)6/h7-9H,10-11H2,1-6H3 |
| InChIKey | MKOMOMPBKSGWRW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|