C11H16N2O5S — CID 64999478
2,2-dimethyl-3-(3-nitrophenoxy)propane-1-sulfonamide (PubChem CID 64999478) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 2,2-dimethyl-3-(3-nitrophenoxy)propane-1-sulfonamide.
| Compound Name | 2,2-dimethyl-3-(3-nitrophenoxy)propane-1-sulfonamide |
|---|---|
| PubChem CID | 64999478 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2,2-dimethyl-3-(3-nitrophenoxy)propane-1-sulfonamide |
| SMILES | CC(C)(COc1cccc([N+](=O)[O-])c1)CS(N)(=O)=O |
| InChI | InChI=1S/C11H16N2O5S/c1-11(2,8-19(12,16)17)7-18-10-5-3-4-9(6-10)13(14)15/h3-6H,7-8H2,1-2H3,(H2,12,16,17) |
| InChIKey | SMTBBRPDZJUSKW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|