C13H5N3O7 — CID 3117442
1,3,7-trinitrofluoren-9-one (PubChem CID 3117442) has the molecular formula C13H5N3O7 and a molecular weight of 315.20 g/mol. Its IUPAC name is 1,3,7-trinitrofluoren-9-one.
| Compound Name | 1,3,7-trinitrofluoren-9-one |
|---|---|
| PubChem CID | 3117442 |
| Molecular Formula | C13H5N3O7 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1,3,7-trinitrofluoren-9-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2-c2cc([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C13H5N3O7/c17-13-10-3-6(14(18)19)1-2-8(10)9-4-7(15(20)21)5-11(12(9)13)16(22)23/h1-5H |
| InChIKey | XREBAXXUFXUZAY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 146.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|