C13H6N4O9 — CID 20734342
3-(hydroperoxyamino)-1,6,8-trinitrofluoren-9-one (PubChem CID 20734342) has the molecular formula C13H6N4O9 and a molecular weight of 362.21 g/mol. Its IUPAC name is 3-(hydroperoxyamino)-1,6,8-trinitrofluoren-9-one.
| Compound Name | 3-(hydroperoxyamino)-1,6,8-trinitrofluoren-9-one |
|---|---|
| PubChem CID | 20734342 |
| Molecular Formula | C13H6N4O9 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 3-(hydroperoxyamino)-1,6,8-trinitrofluoren-9-one |
| SMILES | O=C1c2c(cc(NOO)cc2[N+](=O)[O-])-c2cc([N+](=O)[O-])cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C13H6N4O9/c18-13-11-7(1-5(14-26-25)2-9(11)16(21)22)8-3-6(15(19)20)4-10(12(8)13)17(23)24/h1-4,14,25H |
| InChIKey | FEBHHEMBQHBLIS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 187.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|