C14H8N4O8 — CID 88919207
9-methyl-2,4,5,7-tetranitro-9H-fluorene (PubChem CID 88919207) has the molecular formula C14H8N4O8 and a molecular weight of 360.24 g/mol. Its IUPAC name is 9-methyl-2,4,5,7-tetranitro-9H-fluorene.
| Compound Name | 9-methyl-2,4,5,7-tetranitro-9H-fluorene |
|---|---|
| PubChem CID | 88919207 |
| Molecular Formula | C14H8N4O8 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 9-methyl-2,4,5,7-tetranitro-9H-fluorene |
| SMILES | CC1c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C14H8N4O8/c1-6-9-2-7(15(19)20)4-11(17(23)24)13(9)14-10(6)3-8(16(21)22)5-12(14)18(25)26/h2-6H,1H3 |
| InChIKey | DGIPOMOQQNYZOG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|