C16H11N5O11 — CID 89365869
methyl 2-[(2,4,5,7-tetranitro-9H-fluoren-9-yl)amino]oxyacetate (PubChem CID 89365869) has the molecular formula C16H11N5O11 and a molecular weight of 449.29 g/mol. Its IUPAC name is methyl 2-[(2,4,5,7-tetranitro-9H-fluoren-9-yl)amino]oxyacetate.
| Compound Name | methyl 2-[(2,4,5,7-tetranitro-9H-fluoren-9-yl)amino]oxyacetate |
|---|---|
| PubChem CID | 89365869 |
| Molecular Formula | C16H11N5O11 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | methyl 2-[(2,4,5,7-tetranitro-9H-fluoren-9-yl)amino]oxyacetate |
| SMILES | COC(=O)CONC1c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C16H11N5O11/c1-31-13(22)6-32-17-16-9-2-7(18(23)24)4-11(20(27)28)14(9)15-10(16)3-8(19(25)26)5-12(15)21(29)30/h2-5,16-17H,6H2,1H3 |
| InChIKey | MBPPJEGNVZOQKZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 220.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|