C13H9N3O6 — CID 22342000
2-(4-methylphenyl)-1,3,5-trinitrobenzene (PubChem CID 22342000) has the molecular formula C13H9N3O6 and a molecular weight of 303.23 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1,3,5-trinitrobenzene.
| Compound Name | 2-(4-methylphenyl)-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 22342000 |
| Molecular Formula | C13H9N3O6 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-(4-methylphenyl)-1,3,5-trinitrobenzene |
| SMILES | Cc1ccc(-c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9N3O6/c1-8-2-4-9(5-3-8)13-11(15(19)20)6-10(14(17)18)7-12(13)16(21)22/h2-7H,1H3 |
| InChIKey | FPNLDECTKFUSBJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|