C12H10N4O7 — CID 121007043
3-methylpyridin-1-ium;2,4,6-trinitrophenolate (PubChem CID 121007043) has the molecular formula C12H10N4O7 and a molecular weight of 322.23 g/mol. Its IUPAC name is 3-methylpyridin-1-ium;2,4,6-trinitrophenolate.
| Compound Name | 3-methylpyridin-1-ium;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 121007043 |
| Molecular Formula | C12H10N4O7 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-methylpyridin-1-ium;2,4,6-trinitrophenolate |
| SMILES | Cc1ccc[nH+]c1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C6H7N/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;1-6-3-2-4-7-5-6/h1-2,10H;2-5H,1H3 |
| InChIKey | YTBDOMKYCRLEAW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 166.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|