C33H25N6O14Sb — CID 137187108
2-[[[(3,5-dinitro-4-oxidophenyl)-oxoazaniumyl]oxy-tris(4-methylphenyl)-λ5-stibanyl]oxy-oxoazaniumyl]-4,6-dinitrophenolate (PubChem CID 137187108) has the molecular formula C33H25N6O14Sb and a molecular weight of 851.35 g/mol. Its IUPAC name is 2-[[[(3,5-dinitro-4-oxidophenyl)-oxoazaniumyl]oxy-tris(4-methylphenyl)-λ5-stibanyl]oxy-oxoazaniumyl]-4,6-dinitrophenolate.
| Compound Name | 2-[[[(3,5-dinitro-4-oxidophenyl)-oxoazaniumyl]oxy-tris(4-methylphenyl)-λ5-stibanyl]oxy-oxoazaniumyl]-4,6-dinitrophenolate |
|---|---|
| PubChem CID | 137187108 |
| Molecular Formula | C33H25N6O14Sb |
| Molecular Weight | 851.35 g/mol |
| Exact Mass | 850.05 |
| IUPAC Name | 2-[[[(3,5-dinitro-4-oxidophenyl)-oxoazaniumyl]oxy-tris(4-methylphenyl)-λ5-stibanyl]oxy-oxoazaniumyl]-4,6-dinitrophenolate |
| SMILES | Cc1ccc([Sb](O[N+](=O)c2cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c2)(O[N+](=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2[O-])(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/3C7H7.2C6H3N3O7.Sb/c3*1-7-5-3-2-4-6-7;2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h3*3-6H,1H3;2*1-2,10H;/q;;;;;+2/p-2 |
| InChIKey | IHUNCOYPRXCKMT-UHFFFAOYSA-L |
| XLogP | 3.89 |
| TPSA | 277.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|