C15H13N4O8- — CID 175684338
2-methoxy-N-methylcyclohepta-2,4,6-trien-1-imine;2,4,6-trinitrophenolate (PubChem CID 175684338) has the molecular formula C15H13N4O8- and a molecular weight of 377.29 g/mol. Its IUPAC name is 2-methoxy-N-methylcyclohepta-2,4,6-trien-1-imine;2,4,6-trinitrophenolate.
| Compound Name | 2-methoxy-N-methylcyclohepta-2,4,6-trien-1-imine;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 175684338 |
| Molecular Formula | C15H13N4O8- |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2-methoxy-N-methylcyclohepta-2,4,6-trien-1-imine;2,4,6-trinitrophenolate |
| SMILES | C/N=c1\cccccc1OC.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H11NO.C6H3N3O7/c1-10-8-6-4-3-5-7-9(8)11-2;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-7H,1-2H3;1-2,10H/p-1/b10-8+; |
| InChIKey | HYNXLIVWGBFDAK-VRTOBVRTSA-M |
| XLogP | 1.71 |
| TPSA | 174.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|