C20H11N5O9 — CID 59920571
N-(2-methoxyphenyl)-2,4,5,7-tetranitrofluoren-9-imine (PubChem CID 59920571) has the molecular formula C20H11N5O9 and a molecular weight of 465.33 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2,4,5,7-tetranitrofluoren-9-imine.
| Compound Name | N-(2-methoxyphenyl)-2,4,5,7-tetranitrofluoren-9-imine |
|---|---|
| PubChem CID | 59920571 |
| Molecular Formula | C20H11N5O9 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | N-(2-methoxyphenyl)-2,4,5,7-tetranitrofluoren-9-imine |
| SMILES | COc1ccccc1N=C1c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C20H11N5O9/c1-34-17-5-3-2-4-14(17)21-20-12-6-10(22(26)27)8-15(24(30)31)18(12)19-13(20)7-11(23(28)29)9-16(19)25(32)33/h2-9H,1H3 |
| InChIKey | DQDKCSNGEDNFTP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 194.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|