C24H20N4O6 — CID 54489624
2-ethyl-3,5,7-trinitro-N-(2-propan-2-ylphenyl)fluoren-9-imine (PubChem CID 54489624) has the molecular formula C24H20N4O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is 2-ethyl-3,5,7-trinitro-N-(2-propan-2-ylphenyl)fluoren-9-imine.
| Compound Name | 2-ethyl-3,5,7-trinitro-N-(2-propan-2-ylphenyl)fluoren-9-imine |
|---|---|
| PubChem CID | 54489624 |
| Molecular Formula | C24H20N4O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-ethyl-3,5,7-trinitro-N-(2-propan-2-ylphenyl)fluoren-9-imine |
| SMILES | CCc1cc2c(cc1[N+](=O)[O-])-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])/C2=N/c1ccccc1C(C)C |
| InChI | InChI=1S/C24H20N4O6/c1-4-14-9-18-17(12-21(14)27(31)32)23-19(10-15(26(29)30)11-22(23)28(33)34)24(18)25-20-8-6-5-7-16(20)13(2)3/h5-13H,4H2,1-3H3/b25-24+ |
| InChIKey | XUULYXOKVCUTIZ-OCOZRVBESA-N |
| XLogP | 6.25 |
| TPSA | 141.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|