C25H5F9N4O6 — CID 22899739
2,4,7-trinitro-N-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]fluoren-9-imine (PubChem CID 22899739) has the molecular formula C25H5F9N4O6 and a molecular weight of 628.32 g/mol. Its IUPAC name is 2,4,7-trinitro-N-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]fluoren-9-imine.
| Compound Name | 2,4,7-trinitro-N-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]fluoren-9-imine |
|---|---|
| PubChem CID | 22899739 |
| Molecular Formula | C25H5F9N4O6 |
| Molecular Weight | 628.32 g/mol |
| Exact Mass | 628.01 |
| IUPAC Name | 2,4,7-trinitro-N-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]fluoren-9-imine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)/C(=N\c1c(F)c(F)c(-c3c(F)c(F)c(F)c(F)c3F)c(F)c1F)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C25H5F9N4O6/c26-15-13(16(27)20(31)21(32)19(15)30)14-17(28)22(33)25(23(34)18(14)29)35-24-9-3-6(36(39)40)1-2-8(9)12-10(24)4-7(37(41)42)5-11(12)38(43)44/h1-5H/b35-24+ |
| InChIKey | NUVBAHWPWBKYIV-JWHWKPFMSA-N |
| XLogP | 7.48 |
| TPSA | 141.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.32 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|