C20H10ClN5O7 — CID 6279618
4-chloro-N-[(E)-(2,4,7-trinitrofluoren-9-ylidene)amino]benzamide (PubChem CID 6279618) has the molecular formula C20H10ClN5O7 and a molecular weight of 467.78 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(2,4,7-trinitrofluoren-9-ylidene)amino]benzamide.
| Compound Name | 4-chloro-N-[(E)-(2,4,7-trinitrofluoren-9-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 6279618 |
| Molecular Formula | C20H10ClN5O7 |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 4-chloro-N-[(E)-(2,4,7-trinitrofluoren-9-ylidene)amino]benzamide |
| SMILES | O=C(N/N=C1\c2cc([N+](=O)[O-])ccc2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H10ClN5O7/c21-11-3-1-10(2-4-11)20(27)23-22-19-15-7-12(24(28)29)5-6-14(15)18-16(19)8-13(25(30)31)9-17(18)26(32)33/h1-9H,(H,23,27)/b22-19+ |
| InChIKey | KMOGZEZRCQBTGJ-ZBJSNUHESA-N |
| XLogP | 4.23 |
| TPSA | 170.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_phenone_zone_A(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|