C20H10ClN3O6 — CID 5285985
(9E)-9-[(4-chlorophenyl)methylidene]-2,4,7-trinitrofluorene (PubChem CID 5285985) has the molecular formula C20H10ClN3O6 and a molecular weight of 423.77 g/mol. Its IUPAC name is (9E)-9-[(4-chlorophenyl)methylidene]-2,4,7-trinitrofluorene.
| Compound Name | (9E)-9-[(4-chlorophenyl)methylidene]-2,4,7-trinitrofluorene |
|---|---|
| PubChem CID | 5285985 |
| Molecular Formula | C20H10ClN3O6 |
| Molecular Weight | 423.77 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | (9E)-9-[(4-chlorophenyl)methylidene]-2,4,7-trinitrofluorene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)/C(=C\c1ccc(Cl)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C20H10ClN3O6/c21-12-3-1-11(2-4-12)7-16-17-8-13(22(25)26)5-6-15(17)20-18(16)9-14(23(27)28)10-19(20)24(29)30/h1-10H/b16-7+ |
| InChIKey | TVWVSNIBSNCZTL-FRKPEAEDSA-N |
| XLogP | 5.63 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.77 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|