C22H13N3O9 — CID 3114970
9-[(4-methoxyphenyl)methylidene]-2,5,7-trinitrofluorene-4-carboxylic acid (PubChem CID 3114970) has the molecular formula C22H13N3O9 and a molecular weight of 463.36 g/mol. Its IUPAC name is 9-[(4-methoxyphenyl)methylidene]-2,5,7-trinitrofluorene-4-carboxylic acid.
| Compound Name | 9-[(4-methoxyphenyl)methylidene]-2,5,7-trinitrofluorene-4-carboxylic acid |
|---|---|
| PubChem CID | 3114970 |
| Molecular Formula | C22H13N3O9 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 9-[(4-methoxyphenyl)methylidene]-2,5,7-trinitrofluorene-4-carboxylic acid |
| SMILES | COc1ccc(C=C2c3cc([N+](=O)[O-])cc(C(=O)O)c3-c3c2cc([N+](=O)[O-])cc3[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13N3O9/c1-34-14-4-2-11(3-5-14)6-15-16-7-12(23(28)29)9-18(22(26)27)20(16)21-17(15)8-13(24(30)31)10-19(21)25(32)33/h2-10H,1H3,(H,26,27) |
| InChIKey | ACRADYLGVGIICM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 175.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|