C20H9BrN4O8 — CID 2775540
9-[(4-bromophenyl)methylidene]-2,4,5,7-tetranitrofluorene (PubChem CID 2775540) has the molecular formula C20H9BrN4O8 and a molecular weight of 513.22 g/mol. Its IUPAC name is 9-[(4-bromophenyl)methylidene]-2,4,5,7-tetranitrofluorene.
| Compound Name | 9-[(4-bromophenyl)methylidene]-2,4,5,7-tetranitrofluorene |
|---|---|
| PubChem CID | 2775540 |
| Molecular Formula | C20H9BrN4O8 |
| Molecular Weight | 513.22 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | 9-[(4-bromophenyl)methylidene]-2,4,5,7-tetranitrofluorene |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H9BrN4O8/c21-11-3-1-10(2-4-11)5-14-15-6-12(22(26)27)8-17(24(30)31)19(15)20-16(14)7-13(23(28)29)9-18(20)25(32)33/h1-9H |
| InChIKey | HBPWIUKYCWZADM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.22 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|