About CID 10908090
CID 10908090 (PubChem CID 10908090) has the molecular formula C28H18FeN4O8+2
and a molecular weight of 594.32 g/mol.
Molecular Properties
| Compound Name | CID 10908090 |
| PubChem CID | 10908090 |
| Molecular Formula | C28H18FeN4O8+2 |
| Molecular Weight | 594.32 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=C/C=C/C=C/[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C23H13N4O8.C5H5.Fe/c28-24(29)15-10-18-17(9-3-1-2-6-14-7-4-5-8-14)19-11-16(25(30)31)13-21(27(34)35)23(19)22(18)20(12-15)26(32)33;1-2-4-5-3-1;/h1-13H;1-5H;/q;;+2/b3-1+,6-2+;; |
| InChIKey | IBMAXTHQHBXXHJ-IMZZXFMJSA-N |
| XLogP | 6.27 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 594.32 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 10908090 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10908090?
The IUPAC name of CID 10908090 (CID 10908090) is not available.
What is the SMILES notation for CID 10908090?
The canonical SMILES for CID 10908090 is O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=C/C=C/C=C/[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10908090?
The InChIKey is IBMAXTHQHBXXHJ-IMZZXFMJSA-N. The full InChI is InChI=1S/C23H13N4O8.C5H5.Fe/c28-24(29)15-10-18-17(9-3-1-2-6-14-7-4-5-8-14)19-11-16(25(30)31)13-21(27(34)35)23(19)22(18)20(12-15)26(32)33;1-2-4-5-3-1;/h1-13H;1-5H;/q;;+2/b3-1+,6-2+;;.
What are the key properties of CID 10908090?
CID 10908090 has a molecular weight of 594.32 g/mol, XLogP of 6.27, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10908090 is sourced from PubChem (CID 10908090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).