C18H8N4O8S3 — CID 10744114
2-(2,4,5,7-tetranitrofluoren-9-ylidene)-4,6-dihydrothieno[3,4-d][1,3]dithiole (PubChem CID 10744114) has the molecular formula C18H8N4O8S3 and a molecular weight of 504.48 g/mol. Its IUPAC name is 2-(2,4,5,7-tetranitrofluoren-9-ylidene)-4,6-dihydrothieno[3,4-d][1,3]dithiole.
| Compound Name | 2-(2,4,5,7-tetranitrofluoren-9-ylidene)-4,6-dihydrothieno[3,4-d][1,3]dithiole |
|---|---|
| PubChem CID | 10744114 |
| Molecular Formula | C18H8N4O8S3 |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | 2-(2,4,5,7-tetranitrofluoren-9-ylidene)-4,6-dihydrothieno[3,4-d][1,3]dithiole |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=C1SC2=C(CSC2)S1 |
| InChI | InChI=1S/C18H8N4O8S3/c23-19(24)7-1-9-15(18-32-13-5-31-6-14(13)33-18)10-2-8(20(25)26)4-12(22(29)30)17(10)16(9)11(3-7)21(27)28/h1-4H,5-6H2 |
| InChIKey | PVSVZBJNGLLIDO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|