C13H7CuN3O6 — CID 174761143
copper;2,4,7-trinitro-9H-fluorene (PubChem CID 174761143) has the molecular formula C13H7CuN3O6 and a molecular weight of 364.76 g/mol. Its IUPAC name is copper;2,4,7-trinitro-9H-fluorene.
| Compound Name | copper;2,4,7-trinitro-9H-fluorene |
|---|---|
| PubChem CID | 174761143 |
| Molecular Formula | C13H7CuN3O6 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | copper;2,4,7-trinitro-9H-fluorene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)Cc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2.[Cu] |
| InChI | InChI=1S/C13H7N3O6.Cu/c17-14(18)9-1-2-11-7(4-9)3-8-5-10(15(19)20)6-12(13(8)11)16(21)22;/h1-2,4-6H,3H2; |
| InChIKey | RXNZUSJBDRDYDF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|