C22H10N6O12 — CID 102507077
1,5-bis(2,4,6-trinitrophenyl)naphthalene (PubChem CID 102507077) has the molecular formula C22H10N6O12 and a molecular weight of 550.35 g/mol. Its IUPAC name is 1,5-bis(2,4,6-trinitrophenyl)naphthalene.
| Compound Name | 1,5-bis(2,4,6-trinitrophenyl)naphthalene |
|---|---|
| PubChem CID | 102507077 |
| Molecular Formula | C22H10N6O12 |
| Molecular Weight | 550.35 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | 1,5-bis(2,4,6-trinitrophenyl)naphthalene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(-c2cccc3c(-c4c([N+](=O)[O-])cc([N+](=O)[O-])cc4[N+](=O)[O-])cccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H10N6O12/c29-23(30)11-7-17(25(33)34)21(18(8-11)26(35)36)15-5-1-3-13-14(15)4-2-6-16(13)22-19(27(37)38)9-12(24(31)32)10-20(22)28(39)40/h1-10H |
| InChIKey | DLUHVCHMQSIWJC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 258.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|