C18H9N3O6 — CID 86227277
1,5,9-trinitrotriphenylene (PubChem CID 86227277) has the molecular formula C18H9N3O6 and a molecular weight of 363.29 g/mol. Its IUPAC name is 1,5,9-trinitrotriphenylene.
| Compound Name | 1,5,9-trinitrotriphenylene |
|---|---|
| PubChem CID | 86227277 |
| Molecular Formula | C18H9N3O6 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 1,5,9-trinitrotriphenylene |
| SMILES | O=[N+]([O-])c1cccc2c1c1cccc([N+](=O)[O-])c1c1cccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C18H9N3O6/c22-19(23)13-7-1-4-10-16(13)11-5-2-9-15(21(26)27)18(11)12-6-3-8-14(17(10)12)20(24)25/h1-9H |
| InChIKey | DYWBFPRQOQOYPL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|