C8H4N4O5 — CID 157320634
4,5-dinitro-2H-phthalazin-1-one (PubChem CID 157320634) has the molecular formula C8H4N4O5 and a molecular weight of 236.14 g/mol. Its IUPAC name is 4,5-dinitro-2H-phthalazin-1-one.
| Compound Name | 4,5-dinitro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 157320634 |
| Molecular Formula | C8H4N4O5 |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 4,5-dinitro-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc([N+](=O)[O-])c2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C8H4N4O5/c13-8-4-2-1-3-5(11(14)15)6(4)7(9-10-8)12(16)17/h1-3H,(H,10,13) |
| InChIKey | RCSQEELKHYAYRB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|